C19H18F2N4O — CID 174161470
3-fluoro-4-[[5-(2-fluoro-4-methoxyanilino)-4-methyl-3-pyridinyl]methyl]pyridin-2-amine (PubChem CID 174161470) has the molecular formula C19H18F2N4O and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-fluoro-4-[[5-(2-fluoro-4-methoxyanilino)-4-methyl-3-pyridinyl]methyl]pyridin-2-amine.
| Compound Name | 3-fluoro-4-[[5-(2-fluoro-4-methoxyanilino)-4-methyl-3-pyridinyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 174161470 |
| Molecular Formula | C19H18F2N4O |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-fluoro-4-[[5-(2-fluoro-4-methoxyanilino)-4-methyl-3-pyridinyl]methyl]pyridin-2-amine |
| SMILES | COc1ccc(Nc2cncc(Cc3ccnc(N)c3F)c2C)c(F)c1 |
| InChI | InChI=1S/C19H18F2N4O/c1-11-13(7-12-5-6-24-19(22)18(12)21)9-23-10-17(11)25-16-4-3-14(26-2)8-15(16)20/h3-6,8-10,25H,7H2,1-2H3,(H2,22,24) |
| InChIKey | DWOSRIJISPKCOI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |