C15H20O6 — CID 174162129
(2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioic acid (PubChem CID 174162129) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioic acid.
| Compound Name | (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioic acid |
|---|---|
| PubChem CID | 174162129 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioic acid |
| SMILES | CCC[C@]12CCCC=C1C([C@H](CC(=O)O)C(=O)O)OC2=O |
| InChI | InChI=1S/C15H20O6/c1-2-6-15-7-4-3-5-10(15)12(21-14(15)20)9(13(18)19)8-11(16)17/h5,9,12H,2-4,6-8H2,1H3,(H,16,17)(H,18,19)/t9-,12?,15-/m0/s1 |
| InChIKey | OKARKGQSZAECFR-VDUKQYIUSA-N |
| XLogP | 1.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|