About 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane
1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane (PubChem CID 174162217) has the molecular formula C15H27Br3O2
and a molecular weight of 479.09 g/mol. Its IUPAC name is 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane.
Molecular Properties
| Compound Name | 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane |
| PubChem CID | 174162217 |
| Molecular Formula | C15H27Br3O2 |
| Molecular Weight | 479.09 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane |
| SMILES | COCC(CCC(Br)(Br)Br)(COC)C1CCC(C)CC1 |
| InChI | InChI=1S/C15H27Br3O2/c1-12-4-6-13(7-5-12)14(10-19-2,11-20-3)8-9-15(16,17)18/h12-13H,4-11H2,1-3H3 |
| InChIKey | SYENCHIWYBVCDB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.09 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane?
The IUPAC name of 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane (CID 174162217) is 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane.
What is the SMILES notation for 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane?
The canonical SMILES for 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane is COCC(CCC(Br)(Br)Br)(COC)C1CCC(C)CC1.
What is the InChIKey of 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane?
The InChIKey is SYENCHIWYBVCDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27Br3O2/c1-12-4-6-13(7-5-12)14(10-19-2,11-20-3)8-9-15(16,17)18/h12-13H,4-11H2,1-3H3.
What are the key properties of 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane?
1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane has a molecular weight of 479.09 g/mol, XLogP of 5.71, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[5,5,5-tribromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]cyclohexane is sourced from PubChem (CID 174162217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).