C23H21F3N6O2 — CID 174162995
2,3-dimethyl-6-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]-8-(2,4,5-trifluorophenyl)pyrido[3,4-d]pyrimidin-4-one (PubChem CID 174162995) has the molecular formula C23H21F3N6O2 and a molecular weight of 470.46 g/mol. Its IUPAC name is 2,3-dimethyl-6-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]-8-(2,4,5-trifluorophenyl)pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2,3-dimethyl-6-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]-8-(2,4,5-trifluorophenyl)pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 174162995 |
| Molecular Formula | C23H21F3N6O2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2,3-dimethyl-6-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]-8-(2,4,5-trifluorophenyl)pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(-c3cc(F)c(F)cc3F)nc(N3CCOC(c4cnn(C)c4)C3)cc2c(=O)n1C |
| InChI | InChI=1S/C23H21F3N6O2/c1-12-28-22-15(23(33)31(12)3)7-20(29-21(22)14-6-17(25)18(26)8-16(14)24)32-4-5-34-19(11-32)13-9-27-30(2)10-13/h6-10,19H,4-5,11H2,1-3H3 |
| InChIKey | PEVJEGZEZVSVEL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|