C13H17F — CID 174163203
8-fluoro-4-methyl-1,2,3,3a,4,5,6,7-octahydro-s-indacene (PubChem CID 174163203) has the molecular formula C13H17F and a molecular weight of 192.28 g/mol. Its IUPAC name is 8-fluoro-4-methyl-1,2,3,3a,4,5,6,7-octahydro-s-indacene.
| Compound Name | 8-fluoro-4-methyl-1,2,3,3a,4,5,6,7-octahydro-s-indacene |
|---|---|
| PubChem CID | 174163203 |
| Molecular Formula | C13H17F |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 8-fluoro-4-methyl-1,2,3,3a,4,5,6,7-octahydro-s-indacene |
| SMILES | CC1C2=C(CCC2)C(F)=C2CCCC21 |
| InChI | InChI=1S/C13H17F/c1-8-9-4-2-6-11(9)13(14)12-7-3-5-10(8)12/h8-9H,2-7H2,1H3 |
| InChIKey | NCQLEOHHEGWICT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |