About CID 174163302
CID 174163302 (PubChem CID 174163302) has the molecular formula C3H6BN2O
and a molecular weight of 96.91 g/mol.
Molecular Properties
| Compound Name | CID 174163302 |
| PubChem CID | 174163302 |
| Molecular Formula | C3H6BN2O |
| Molecular Weight | 96.91 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | — |
| SMILES | [H]/N=C/C([B]O)=C\N |
| InChI | InChI=1S/C3H6BN2O/c5-1-3(2-6)4-7/h1-2,5,7H,6H2/b3-2+,5-1+ |
| InChIKey | JLMZVMSQZSCAET-KQRCDPSGSA-N |
| XLogP | -0.95 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.91 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 174163302 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174163302?
The IUPAC name of CID 174163302 (CID 174163302) is not available.
What is the SMILES notation for CID 174163302?
The canonical SMILES for CID 174163302 is [H]/N=C/C([B]O)=C\N.
What is the InChIKey of CID 174163302?
The InChIKey is JLMZVMSQZSCAET-KQRCDPSGSA-N. The full InChI is InChI=1S/C3H6BN2O/c5-1-3(2-6)4-7/h1-2,5,7H,6H2/b3-2+,5-1+.
What are the key properties of CID 174163302?
CID 174163302 has a molecular weight of 96.91 g/mol, XLogP of -0.95, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174163302 is sourced from PubChem (CID 174163302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).