C21H31N3O3S — CID 174163493
4-cyclohexyl-2-cyclopentyl-N-[(E)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide (PubChem CID 174163493) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 4-cyclohexyl-2-cyclopentyl-N-[(E)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 4-cyclohexyl-2-cyclopentyl-N-[(E)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 174163493 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-cyclohexyl-2-cyclopentyl-N-[(E)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide |
| SMILES | CC(/C=C/S(C)(=O)=O)NC(=O)c1cnc(C2CCCC2)nc1C1CCCCC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-15(12-13-28(2,26)27)23-21(25)18-14-22-20(17-10-6-7-11-17)24-19(18)16-8-4-3-5-9-16/h12-17H,3-11H2,1-2H3,(H,23,25)/b13-12+ |
| InChIKey | OWUWLQPTEANEPM-OUKQBFOZSA-N |
| XLogP | 3.86 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |