C21H40O4Si — CID 174163688
(E,2S)-2-methoxy-3,4,7,7-tetramethyl-8-triethylsilyloxydec-3-ene-5,6-dione (PubChem CID 174163688) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (E,2S)-2-methoxy-3,4,7,7-tetramethyl-8-triethylsilyloxydec-3-ene-5,6-dione.
| Compound Name | (E,2S)-2-methoxy-3,4,7,7-tetramethyl-8-triethylsilyloxydec-3-ene-5,6-dione |
|---|---|
| PubChem CID | 174163688 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (E,2S)-2-methoxy-3,4,7,7-tetramethyl-8-triethylsilyloxydec-3-ene-5,6-dione |
| SMILES | CCC(O[Si](CC)(CC)CC)C(C)(C)C(=O)C(=O)/C(C)=C(\C)[C@H](C)OC |
| InChI | InChI=1S/C21H40O4Si/c1-11-18(25-26(12-2,13-3)14-4)21(8,9)20(23)19(22)16(6)15(5)17(7)24-10/h17-18H,11-14H2,1-10H3/b16-15+/t17-,18?/m0/s1 |
| InChIKey | LICPIOSYGAOGSL-QNUTZRAZSA-N |
| XLogP | 5.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|