C18H22F3NO4 — CID 174163846
[(4S,5R)-4,5,6-trimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 174163846) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is [(4S,5R)-4,5,6-trimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(4S,5R)-4,5,6-trimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 174163846 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(4S,5R)-4,5,6-trimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(O/C(=N/c2ccccc2)C(F)(F)F)OC(C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H22F3NO4/c1-10-11(2)15(25-13(4)23)16(24-12(10)3)26-17(18(19,20)21)22-14-8-6-5-7-9-14/h5-12,15-16H,1-4H3/b22-17+/t10-,11+,12?,15?,16?/m1/s1 |
| InChIKey | RQSIOTDEACDPRN-FCSYOHLZSA-N |
| XLogP | 4.24 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|