C14H25N3O2S — CID 174164085
(2S)-N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide (PubChem CID 174164085) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is (2S)-N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 174164085 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (2S)-N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@@H]1CCS[C@H]2CC(C)(C)CN2C1=O |
| InChI | InChI=1S/C14H25N3O2S/c1-9(15-4)12(18)16-10-5-6-20-11-7-14(2,3)8-17(11)13(10)19/h9-11,15H,5-8H2,1-4H3,(H,16,18)/t9-,10+,11-/m0/s1 |
| InChIKey | KEVRUDQHVJTHAW-AXFHLTTASA-N |
| XLogP | 0.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |