C13H23N3O2S — CID 174164268
N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)acetamide (PubChem CID 174164268) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)acetamide.
| Compound Name | N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 174164268 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(4R,9aS)-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)N[C@@H]1CCS[C@H]2CC(C)(C)CN2C1=O |
| InChI | InChI=1S/C13H23N3O2S/c1-13(2)6-11-16(8-13)12(18)9(4-5-19-11)15-10(17)7-14-3/h9,11,14H,4-8H2,1-3H3,(H,15,17)/t9-,11+/m1/s1 |
| InChIKey | SHHCAYCITRCRIC-KOLCDFICSA-N |
| XLogP | 0.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |