C11H15F6NO3 — CID 174164379
1,1,1,3,3,3-hexafluoropropan-2-yl (2S,3S)-3-hydroxy-1-propan-2-ylpyrrolidine-2-carboxylate (PubChem CID 174164379) has the molecular formula C11H15F6NO3 and a molecular weight of 323.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (2S,3S)-3-hydroxy-1-propan-2-ylpyrrolidine-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S,3S)-3-hydroxy-1-propan-2-ylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 174164379 |
| Molecular Formula | C11H15F6NO3 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S,3S)-3-hydroxy-1-propan-2-ylpyrrolidine-2-carboxylate |
| SMILES | CC(C)N1CC[C@H](O)[C@H]1C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6NO3/c1-5(2)18-4-3-6(19)7(18)8(20)21-9(10(12,13)14)11(15,16)17/h5-7,9,19H,3-4H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | REGVBBJZOZOXNF-BQBZGAKWSA-N |
| XLogP | 1.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |