C16H31NO2 — CID 174164420
methyl (2S,5S)-5-methyl-1-nonan-2-ylpyrrolidine-2-carboxylate (PubChem CID 174164420) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is methyl (2S,5S)-5-methyl-1-nonan-2-ylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,5S)-5-methyl-1-nonan-2-ylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 174164420 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | methyl (2S,5S)-5-methyl-1-nonan-2-ylpyrrolidine-2-carboxylate |
| SMILES | CCCCCCCC(C)N1[C@@H](C)CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C16H31NO2/c1-5-6-7-8-9-10-13(2)17-14(3)11-12-15(17)16(18)19-4/h13-15H,5-12H2,1-4H3/t13?,14-,15-/m0/s1 |
| InChIKey | NWXNZTGECUQACT-FGRDXJNISA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|