About (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid
(4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 174164554) has the molecular formula C16H31NO2S
and a molecular weight of 301.50 g/mol. Its IUPAC name is (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 174164554 |
| Molecular Formula | C16H31NO2S |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCCCC(CCCC)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C16H31NO2S/c1-3-5-7-8-9-11-14(10-6-4-2)17-13-20-12-15(17)16(18)19/h14-15H,3-13H2,1-2H3,(H,18,19)/t14?,15-/m0/s1 |
| InChIKey | SWIMERGDCJZUMA-LOACHALJSA-N |
| XLogP | 4.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid (CID 174164554) is (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid is CCCCCCCC(CCCC)N1CSC[C@H]1C(=O)O.
What is the InChIKey of (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is SWIMERGDCJZUMA-LOACHALJSA-N. The full InChI is InChI=1S/C16H31NO2S/c1-3-5-7-8-9-11-14(10-6-4-2)17-13-20-12-15(17)16(18)19/h14-15H,3-13H2,1-2H3,(H,18,19)/t14?,15-/m0/s1.
What are the key properties of (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid?
(4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 301.50 g/mol, XLogP of 4.37, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-dodecan-5-yl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 174164554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).