About N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide
N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide (PubChem CID 174164829) has the molecular formula C9H12FN3O
and a molecular weight of 197.21 g/mol. Its IUPAC name is N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide |
| PubChem CID | 174164829 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncc(F)cn1 |
| InChI | InChI=1S/C9H12FN3O/c1-9(2,3)7(14)13-8-11-4-6(10)5-12-8/h4-5H,1-3H3,(H,11,12,13,14) |
| InChIKey | RXPIUHUNKXPBAU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide (CID 174164829) is N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1ncc(F)cn1.
What is the InChIKey of N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide?
The InChIKey is RXPIUHUNKXPBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3O/c1-9(2,3)7(14)13-8-11-4-6(10)5-12-8/h4-5H,1-3H3,(H,11,12,13,14).
What are the key properties of N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide?
N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide has a molecular weight of 197.21 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoropyrimidin-2-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 174164829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).