C15H12F3N5O7 — CID 174164894
2-[carboxymethyl-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-2-(2,2,2-trifluoroacetyl)oxyacetic acid (PubChem CID 174164894) has the molecular formula C15H12F3N5O7 and a molecular weight of 431.28 g/mol. Its IUPAC name is 2-[carboxymethyl-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-2-(2,2,2-trifluoroacetyl)oxyacetic acid.
| Compound Name | 2-[carboxymethyl-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-2-(2,2,2-trifluoroacetyl)oxyacetic acid |
|---|---|
| PubChem CID | 174164894 |
| Molecular Formula | C15H12F3N5O7 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 2-[carboxymethyl-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-2-(2,2,2-trifluoroacetyl)oxyacetic acid |
| SMILES | O=C(O)CN(Cc1ccc(-c2nncnn2)cc1O)C(OC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H12F3N5O7/c16-15(17,18)14(29)30-12(13(27)28)23(5-10(25)26)4-8-2-1-7(3-9(8)24)11-21-19-6-20-22-11/h1-3,6,12,24H,4-5H2,(H,25,26)(H,27,28) |
| InChIKey | ABZIKTYBZXDUFZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 175.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|