C17H17F4N5O7 — CID 174164909
2-[carboxymethyl-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 174164909) has the molecular formula C17H17F4N5O7 and a molecular weight of 479.34 g/mol. Its IUPAC name is 2-[carboxymethyl-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[carboxymethyl-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174164909 |
| Molecular Formula | C17H17F4N5O7 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-[carboxymethyl-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CN(CC(=O)O)Cc1ccc(-c2nncnn2)cc1OCCF |
| InChI | InChI=1S/C15H16FN5O5.C2HF3O2/c16-3-4-26-12-5-10(15-19-17-9-18-20-15)1-2-11(12)6-21(7-13(22)23)8-14(24)25;3-2(4,5)1(6)7/h1-2,5,9H,3-4,6-8H2,(H,22,23)(H,24,25);(H,6,7) |
| InChIKey | GCRZHRGPEJGNTA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 175.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |