C26H32FN3 — CID 174165801
4-[(3E,5E,7E)-9-amino-7-[(Z)-2-(2,2-dimethylpropylamino)ethenyl]-3,6-dimethyldeca-1,3,5,7,9-pentaen-5-yl]-2-fluorobenzonitrile (PubChem CID 174165801) has the molecular formula C26H32FN3 and a molecular weight of 405.56 g/mol. Its IUPAC name is 4-[(3E,5E,7E)-9-amino-7-[(Z)-2-(2,2-dimethylpropylamino)ethenyl]-3,6-dimethyldeca-1,3,5,7,9-pentaen-5-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[(3E,5E,7E)-9-amino-7-[(Z)-2-(2,2-dimethylpropylamino)ethenyl]-3,6-dimethyldeca-1,3,5,7,9-pentaen-5-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 174165801 |
| Molecular Formula | C26H32FN3 |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 4-[(3E,5E,7E)-9-amino-7-[(Z)-2-(2,2-dimethylpropylamino)ethenyl]-3,6-dimethyldeca-1,3,5,7,9-pentaen-5-yl]-2-fluorobenzonitrile |
| SMILES | C=C/C(C)=C/C(=C(C)\C(/C=C\NCC(C)(C)C)=C\C(=C)N)c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C26H32FN3/c1-8-18(2)13-24(22-9-10-23(16-28)25(27)15-22)20(4)21(14-19(3)29)11-12-30-17-26(5,6)7/h8-15,30H,1,3,17,29H2,2,4-7H3/b12-11+,18-13+,21-14+,24-20+ |
| InChIKey | GGUWEIYOVDCHOM-AXDHNBCASA-N |
| XLogP | 6.15 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|