C37H44N2O14 — CID 174166141
[2-[2-[2-[2-(1,1-dihydroxyethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl] 2-[3-hydroxy-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3H-xanthen-9-yl]benzoate (PubChem CID 174166141) has the molecular formula C37H44N2O14 and a molecular weight of 740.76 g/mol. Its IUPAC name is [2-[2-[2-[2-(1,1-dihydroxyethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl] 2-[3-hydroxy-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3H-xanthen-9-yl]benzoate.
| Compound Name | [2-[2-[2-[2-(1,1-dihydroxyethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl] 2-[3-hydroxy-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3H-xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 174166141 |
| Molecular Formula | C37H44N2O14 |
| Molecular Weight | 740.76 g/mol |
| Exact Mass | 740.28 |
| IUPAC Name | [2-[2-[2-[2-(1,1-dihydroxyethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl] 2-[3-hydroxy-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3H-xanthen-9-yl]benzoate |
| SMILES | CC(C)(C)OC(=O)COc1ccc2c(c1)OC1=CC(O)C=CC1=C2c1ccccc1C(=O)OCC(=O)NCCOCCOCCNC(=O)OC(C)(O)O |
| InChI | InChI=1S/C37H44N2O14/c1-36(2,3)52-32(42)22-49-24-10-12-28-30(20-24)51-29-19-23(40)9-11-27(29)33(28)25-7-5-6-8-26(25)34(43)50-21-31(41)38-13-15-47-17-18-48-16-14-39-35(44)53-37(4,45)46/h5-12,19-20,23,40,45-46H,13-18,21-22H2,1-4H3,(H,38,41)(H,39,44) |
| InChIKey | MSWZTPUGRCGONF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 217.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.76 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|