C23H24N4 — CID 174166187
N-[1-[2-(4-aminophenyl)-3-methyl-1,2-dihydrobenzimidazol-5-yl]ethenyl]-3-methylaniline (PubChem CID 174166187) has the molecular formula C23H24N4 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[1-[2-(4-aminophenyl)-3-methyl-1,2-dihydrobenzimidazol-5-yl]ethenyl]-3-methylaniline.
| Compound Name | N-[1-[2-(4-aminophenyl)-3-methyl-1,2-dihydrobenzimidazol-5-yl]ethenyl]-3-methylaniline |
|---|---|
| PubChem CID | 174166187 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[1-[2-(4-aminophenyl)-3-methyl-1,2-dihydrobenzimidazol-5-yl]ethenyl]-3-methylaniline |
| SMILES | C=C(Nc1cccc(C)c1)c1ccc2c(c1)N(C)C(c1ccc(N)cc1)N2 |
| InChI | InChI=1S/C23H24N4/c1-15-5-4-6-20(13-15)25-16(2)18-9-12-21-22(14-18)27(3)23(26-21)17-7-10-19(24)11-8-17/h4-14,23,25-26H,2,24H2,1,3H3 |
| InChIKey | OJNKDKLODBQDSR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|