C23H23FN6OS — CID 174166644
4-[2-(3-amino-4-hydrazinylphenyl)-5-(3-aminopiperidine-1-carbonyl)thiophen-3-yl]-2-fluorobenzonitrile (PubChem CID 174166644) has the molecular formula C23H23FN6OS and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[2-(3-amino-4-hydrazinylphenyl)-5-(3-aminopiperidine-1-carbonyl)thiophen-3-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-(3-amino-4-hydrazinylphenyl)-5-(3-aminopiperidine-1-carbonyl)thiophen-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 174166644 |
| Molecular Formula | C23H23FN6OS |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-[2-(3-amino-4-hydrazinylphenyl)-5-(3-aminopiperidine-1-carbonyl)thiophen-3-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(-c2cc(C(=O)N3CCCC(N)C3)sc2-c2ccc(NN)c(N)c2)cc1F |
| InChI | InChI=1S/C23H23FN6OS/c24-18-8-13(3-4-15(18)11-25)17-10-21(23(31)30-7-1-2-16(26)12-30)32-22(17)14-5-6-20(29-28)19(27)9-14/h3-6,8-10,16,29H,1-2,7,12,26-28H2 |
| InChIKey | HCQDTOLPLOATEO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|