About 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol
6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol (PubChem CID 174166673) has the molecular formula C6H6O2S
and a molecular weight of 142.18 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol |
| PubChem CID | 174166673 |
| Molecular Formula | C6H6O2S |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol |
| SMILES | OCC1(O)c2cscc21 |
| InChI | InChI=1S/C6H6O2S/c7-3-6(8)4-1-9-2-5(4)6/h1-2,7-8H,3H2 |
| InChIKey | MRRLHOKBOOPKKX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol?
The IUPAC name of 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol (CID 174166673) is 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol.
What is the SMILES notation for 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol?
The canonical SMILES for 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol is OCC1(O)c2cscc21.
What is the InChIKey of 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol?
The InChIKey is MRRLHOKBOOPKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S/c7-3-6(8)4-1-9-2-5(4)6/h1-2,7-8H,3H2.
What are the key properties of 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol?
6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol has a molecular weight of 142.18 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-3-thiabicyclo[3.1.0]hexa-1,4-dien-6-ol is sourced from PubChem (CID 174166673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).