About 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile
4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile (PubChem CID 174167120) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile.
Molecular Properties
| Compound Name | 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile |
| PubChem CID | 174167120 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile |
| SMILES | CCOc1cc([C@@H](O)C(C)OC2CCCC2)cc(OCC)c1C#N |
| InChI | InChI=1S/C19H27NO4/c1-4-22-17-10-14(11-18(23-5-2)16(17)12-20)19(21)13(3)24-15-8-6-7-9-15/h10-11,13,15,19,21H,4-9H2,1-3H3/t13?,19-/m0/s1 |
| InChIKey | SJBCAEHAXGCKJJ-YFKXAPIDSA-N |
| XLogP | 3.74 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile?
The IUPAC name of 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile (CID 174167120) is 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile.
What is the SMILES notation for 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile?
The canonical SMILES for 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile is CCOc1cc([C@@H](O)C(C)OC2CCCC2)cc(OCC)c1C#N.
What is the InChIKey of 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile?
The InChIKey is SJBCAEHAXGCKJJ-YFKXAPIDSA-N. The full InChI is InChI=1S/C19H27NO4/c1-4-22-17-10-14(11-18(23-5-2)16(17)12-20)19(21)13(3)24-15-8-6-7-9-15/h10-11,13,15,19,21H,4-9H2,1-3H3/t13?,19-/m0/s1.
What are the key properties of 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile?
4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile has a molecular weight of 333.43 g/mol, XLogP of 3.74, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-2-cyclopentyloxy-1-hydroxypropyl]-2,6-diethoxybenzonitrile is sourced from PubChem (CID 174167120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).