C17H25BF2N2O3 — CID 174167227
1-[[6-amino-2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methyl]cyclobutan-1-ol (PubChem CID 174167227) has the molecular formula C17H25BF2N2O3 and a molecular weight of 354.21 g/mol. Its IUPAC name is 1-[[6-amino-2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methyl]cyclobutan-1-ol.
| Compound Name | 1-[[6-amino-2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 174167227 |
| Molecular Formula | C17H25BF2N2O3 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[[6-amino-2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methyl]cyclobutan-1-ol |
| SMILES | CC1(C)OB(c2cc(N)c(NCC3(O)CCC3)c(F)c2F)OC1(C)C |
| InChI | InChI=1S/C17H25BF2N2O3/c1-15(2)16(3,4)25-18(24-15)10-8-11(21)14(13(20)12(10)19)22-9-17(23)6-5-7-17/h8,22-23H,5-7,9,21H2,1-4H3 |
| InChIKey | ATWSEAGVHPHBLP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|