C27H25F3N6O4S — CID 174167304
3-[5-methyl-6-[(1-oxidospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepin-1-ium-4,1'-cyclopropane]-2-yl)methyl]-2-pyridinyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid (PubChem CID 174167304) has the molecular formula C27H25F3N6O4S and a molecular weight of 586.60 g/mol. Its IUPAC name is 3-[5-methyl-6-[(1-oxidospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepin-1-ium-4,1'-cyclopropane]-2-yl)methyl]-2-pyridinyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid.
| Compound Name | 3-[5-methyl-6-[(1-oxidospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepin-1-ium-4,1'-cyclopropane]-2-yl)methyl]-2-pyridinyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid |
|---|---|
| PubChem CID | 174167304 |
| Molecular Formula | C27H25F3N6O4S |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 3-[5-methyl-6-[(1-oxidospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepin-1-ium-4,1'-cyclopropane]-2-yl)methyl]-2-pyridinyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccn3c(C(F)(F)F)nnc3c2C)nc1CN1CC2(CC2)Oc2ncccc2[S+]1[O-] |
| InChI | InChI=1S/C27H25F3N6O4S/c1-15-5-6-19(18(12-22(37)38)17-7-11-36-23(16(17)2)33-34-25(36)27(28,29)30)32-20(15)13-35-14-26(8-9-26)40-24-21(41(35)39)4-3-10-31-24/h3-7,10-11,18H,8-9,12-14H2,1-2H3,(H,37,38) |
| InChIKey | NQNNYXMMANYEBA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|