C22H19FN2S — CID 174167410
2-fluoro-4-[5-methyl-2-(4-pyrrolidin-1-ylphenyl)thiophen-3-yl]benzonitrile (PubChem CID 174167410) has the molecular formula C22H19FN2S and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-fluoro-4-[5-methyl-2-(4-pyrrolidin-1-ylphenyl)thiophen-3-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[5-methyl-2-(4-pyrrolidin-1-ylphenyl)thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 174167410 |
| Molecular Formula | C22H19FN2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-fluoro-4-[5-methyl-2-(4-pyrrolidin-1-ylphenyl)thiophen-3-yl]benzonitrile |
| SMILES | Cc1cc(-c2ccc(C#N)c(F)c2)c(-c2ccc(N3CCCC3)cc2)s1 |
| InChI | InChI=1S/C22H19FN2S/c1-15-12-20(17-4-5-18(14-24)21(23)13-17)22(26-15)16-6-8-19(9-7-16)25-10-2-3-11-25/h4-9,12-13H,2-3,10-11H2,1H3 |
| InChIKey | VSDHAWRZSKVGEL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |