C28H42O7SSi — CID 174167452
4-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yloxy)-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonic acid (PubChem CID 174167452) has the molecular formula C28H42O7SSi and a molecular weight of 550.79 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yloxy)-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yloxy)-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 174167452 |
| Molecular Formula | C28H42O7SSi |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1H-inden-2-yloxy)-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonic acid |
| SMILES | COc1cc(C(O[Si](C)(C)C(C)(C)C)C(CCS(=O)(=O)O)OC2Cc3ccccc3C2)cc(OC)c1C |
| InChI | InChI=1S/C28H42O7SSi/c1-19-25(32-5)17-22(18-26(19)33-6)27(35-37(7,8)28(2,3)4)24(13-14-36(29,30)31)34-23-15-20-11-9-10-12-21(20)16-23/h9-12,17-18,23-24,27H,13-16H2,1-8H3,(H,29,30,31) |
| InChIKey | SVGAQJUCIDBVED-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|