C19H17Cl2F3N4O2 — CID 174168396
1-[(1S)-6,7-dichloro-1-methyl-9-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone (PubChem CID 174168396) has the molecular formula C19H17Cl2F3N4O2 and a molecular weight of 461.27 g/mol. Its IUPAC name is 1-[(1S)-6,7-dichloro-1-methyl-9-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S)-6,7-dichloro-1-methyl-9-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 174168396 |
| Molecular Formula | C19H17Cl2F3N4O2 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 1-[(1S)-6,7-dichloro-1-methyl-9-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
| SMILES | C[C@H]1c2c([nH]c3c(Cl)c(Cl)cc(-c4cc(C(F)(F)F)nn4C)c23)CCN1C(=O)CO |
| InChI | InChI=1S/C19H17Cl2F3N4O2/c1-8-15-11(3-4-28(8)14(30)7-29)25-18-16(15)9(5-10(20)17(18)21)12-6-13(19(22,23)24)26-27(12)2/h5-6,8,25,29H,3-4,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | VNLCXEUOTXFNMI-QMMMGPOBSA-N |
| XLogP | 4.33 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |