C18H18Cl2N4O2 — CID 174168405
1-[(1S)-6,7-dichloro-1-methyl-9-(2-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone (PubChem CID 174168405) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-[(1S)-6,7-dichloro-1-methyl-9-(2-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S)-6,7-dichloro-1-methyl-9-(2-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 174168405 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-[(1S)-6,7-dichloro-1-methyl-9-(2-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
| SMILES | C[C@H]1c2c([nH]c3c(Cl)c(Cl)cc(-c4ccnn4C)c23)CCN1C(=O)CO |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-9-15-12(4-6-24(9)14(26)8-25)22-18-16(15)10(7-11(19)17(18)20)13-3-5-21-23(13)2/h3,5,7,9,22,25H,4,6,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | HCKRGQLTEATFEO-VIFPVBQESA-N |
| XLogP | 3.31 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |