C23H22F3N3O2S — CID 174169161
N-[(6E,8E)-4-amino-8-(4-cyano-3-fluorophenyl)-3-fluoro-9-(3-fluoro-4-hydroxyphenyl)-9-sulfanylnona-6,8-dienyl]formamide (PubChem CID 174169161) has the molecular formula C23H22F3N3O2S and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[(6E,8E)-4-amino-8-(4-cyano-3-fluorophenyl)-3-fluoro-9-(3-fluoro-4-hydroxyphenyl)-9-sulfanylnona-6,8-dienyl]formamide.
| Compound Name | N-[(6E,8E)-4-amino-8-(4-cyano-3-fluorophenyl)-3-fluoro-9-(3-fluoro-4-hydroxyphenyl)-9-sulfanylnona-6,8-dienyl]formamide |
|---|---|
| PubChem CID | 174169161 |
| Molecular Formula | C23H22F3N3O2S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[(6E,8E)-4-amino-8-(4-cyano-3-fluorophenyl)-3-fluoro-9-(3-fluoro-4-hydroxyphenyl)-9-sulfanylnona-6,8-dienyl]formamide |
| SMILES | N#Cc1ccc(C(/C=C/CC(N)C(F)CCNC=O)=C(/S)c2ccc(O)c(F)c2)cc1F |
| InChI | InChI=1S/C23H22F3N3O2S/c24-18(8-9-29-13-30)21(28)3-1-2-17(14-4-5-16(12-27)19(25)10-14)23(32)15-6-7-22(31)20(26)11-15/h1-2,4-7,10-11,13,18,21,31-32H,3,8-9,28H2,(H,29,30)/b2-1+,23-17+ |
| InChIKey | DCJOGUQKUCAXAO-RFLDDRCNSA-N |
| XLogP | 4.09 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|