About 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene
2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 174169269) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 174169269 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CC(C)C1C2C3C=CC(C3)C2(C)CN1C(C)C |
| InChI | InChI=1S/C16H27N/c1-10(2)15-14-12-6-7-13(8-12)16(14,5)9-17(15)11(3)4/h6-7,10-15H,8-9H2,1-5H3 |
| InChIKey | CSPCRLLIUKHTHH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene (CID 174169269) is 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene is CC(C)C1C2C3C=CC(C3)C2(C)CN1C(C)C.
What is the InChIKey of 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is CSPCRLLIUKHTHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-10(2)15-14-12-6-7-13(8-12)16(14,5)9-17(15)11(3)4/h6-7,10-15H,8-9H2,1-5H3.
What are the key properties of 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene?
2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 233.40 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 174169269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).