C12H16F3NO2S — CID 174169983
2,3,5-trifluoro-N,N,4-trimethyl-6-propan-2-ylbenzenesulfonamide (PubChem CID 174169983) has the molecular formula C12H16F3NO2S and a molecular weight of 295.33 g/mol. Its IUPAC name is 2,3,5-trifluoro-N,N,4-trimethyl-6-propan-2-ylbenzenesulfonamide.
| Compound Name | 2,3,5-trifluoro-N,N,4-trimethyl-6-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 174169983 |
| Molecular Formula | C12H16F3NO2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2,3,5-trifluoro-N,N,4-trimethyl-6-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1c(F)c(F)c(S(=O)(=O)N(C)C)c(C(C)C)c1F |
| InChI | InChI=1S/C12H16F3NO2S/c1-6(2)8-9(13)7(3)10(14)11(15)12(8)19(17,18)16(4)5/h6H,1-5H3 |
| InChIKey | OQUIOGUVDNDWES-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|