C12H17N3O2 — CID 174170040
1-[(E)-1-[[(1Z)-buta-1,3-dienyl]-methylamino]prop-1-enyl]-1,3-diazinane-2,4-dione (PubChem CID 174170040) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[(E)-1-[[(1Z)-buta-1,3-dienyl]-methylamino]prop-1-enyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(E)-1-[[(1Z)-buta-1,3-dienyl]-methylamino]prop-1-enyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 174170040 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-[(E)-1-[[(1Z)-buta-1,3-dienyl]-methylamino]prop-1-enyl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C=C\N(C)/C(=C\C)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H17N3O2/c1-4-6-8-14(3)11(5-2)15-9-7-10(16)13-12(15)17/h4-6,8H,1,7,9H2,2-3H3,(H,13,16,17)/b8-6-,11-5+ |
| InChIKey | YGVUKMBIIAHXLN-QHPKLMRPSA-N |
| XLogP | 1.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|