C57H36N4O11 — CID 174170075
6-[5-(2,3,4,5,6-pentahydroxyphenyl)-9-[7-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]carbazol-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 174170075) has the molecular formula C57H36N4O11 and a molecular weight of 952.93 g/mol. Its IUPAC name is 6-[5-(2,3,4,5,6-pentahydroxyphenyl)-9-[7-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]carbazol-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[5-(2,3,4,5,6-pentahydroxyphenyl)-9-[7-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]carbazol-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174170075 |
| Molecular Formula | C57H36N4O11 |
| Molecular Weight | 952.93 g/mol |
| Exact Mass | 952.24 |
| IUPAC Name | 6-[5-(2,3,4,5,6-pentahydroxyphenyl)-9-[7-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-4-yl]carbazol-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2ccc3c4c(-c5c(O)c(O)c(O)c(O)c5O)cccc4n(-c4cccc5c4oc4cc(-c6nc(-c7ccccc7)nc(-c7cccc(-c8ccccc8)c7)n6)ccc45)c3c2)c(O)c1O |
| InChI | InChI=1S/C57H36N4O11/c62-44-41(45(63)49(67)52(70)48(44)66)30-20-23-35-39(25-30)61(37-18-9-17-36(42(35)37)43-46(64)50(68)53(71)51(69)47(43)65)38-19-8-16-34-33-22-21-32(26-40(33)72-54(34)38)57-59-55(28-12-5-2-6-13-28)58-56(60-57)31-15-7-14-29(24-31)27-10-3-1-4-11-27/h1-26,62-71H |
| InChIKey | NOAKUTVQJVUVRJ-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 259.04 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.93 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|