C57H35N5O5S — CID 174171073
6-[4-(9-phenylcarbazol-3-yl)-6-[6-(2-phenylcarbazol-9-yl)dibenzothiophen-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 174171073) has the molecular formula C57H35N5O5S and a molecular weight of 902.00 g/mol. Its IUPAC name is 6-[4-(9-phenylcarbazol-3-yl)-6-[6-(2-phenylcarbazol-9-yl)dibenzothiophen-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-(9-phenylcarbazol-3-yl)-6-[6-(2-phenylcarbazol-9-yl)dibenzothiophen-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174171073 |
| Molecular Formula | C57H35N5O5S |
| Molecular Weight | 902.00 g/mol |
| Exact Mass | 901.24 |
| IUPAC Name | 6-[4-(9-phenylcarbazol-3-yl)-6-[6-(2-phenylcarbazol-9-yl)dibenzothiophen-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2nc(-c3ccc4sc5c(-n6c7ccccc7c7ccc(-c8ccccc8)cc76)cccc5c4c3)nc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)n2)c(O)c1O |
| InChI | InChI=1S/C57H35N5O5S/c63-49-48(50(64)52(66)53(67)51(49)65)57-59-55(33-23-26-44-40(28-33)37-17-8-9-19-42(37)61(44)35-14-5-2-6-15-35)58-56(60-57)34-24-27-47-41(29-34)39-18-11-21-45(54(39)68-47)62-43-20-10-7-16-36(43)38-25-22-32(30-46(38)62)31-12-3-1-4-13-31/h1-30,63-67H |
| InChIKey | PVZZWAVCOMKAAM-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.00 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|