C16H26O2 — CID 174171775
2-methyl-5-[5-[(3R)-3-methyl-2,3-dihydrofuran-4-yl]hexan-2-yl]-2,5-dihydrofuran (PubChem CID 174171775) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-methyl-5-[5-[(3R)-3-methyl-2,3-dihydrofuran-4-yl]hexan-2-yl]-2,5-dihydrofuran.
| Compound Name | 2-methyl-5-[5-[(3R)-3-methyl-2,3-dihydrofuran-4-yl]hexan-2-yl]-2,5-dihydrofuran |
|---|---|
| PubChem CID | 174171775 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-methyl-5-[5-[(3R)-3-methyl-2,3-dihydrofuran-4-yl]hexan-2-yl]-2,5-dihydrofuran |
| SMILES | CC1C=CC(C(C)CCC(C)C2=COC[C@@H]2C)O1 |
| InChI | InChI=1S/C16H26O2/c1-11(15-10-17-9-13(15)3)5-6-12(2)16-8-7-14(4)18-16/h7-8,10-14,16H,5-6,9H2,1-4H3/t11?,12?,13-,14?,16?/m0/s1 |
| InChIKey | FYLQCZMDOUKPJV-JMGALGLOSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|