About lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride
lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride (PubChem CID 174172441) has the molecular formula C11H15FLiNO4S
and a molecular weight of 283.25 g/mol. Its IUPAC name is lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride.
Molecular Properties
| Compound Name | lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride |
| PubChem CID | 174172441 |
| Molecular Formula | C11H15FLiNO4S |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride |
| SMILES | CCCCOC(=O)c1cc(F)ccc1S(N)(=O)=O.[H-].[Li+] |
| InChI | InChI=1S/C11H14FNO4S.Li.H/c1-2-3-6-17-11(14)9-7-8(12)4-5-10(9)18(13,15)16;;/h4-5,7H,2-3,6H2,1H3,(H2,13,15,16);;/q;+1;-1 |
| InChIKey | UYNYBGYRUJCVOR-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride?
The IUPAC name of lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride (CID 174172441) is lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride.
What is the SMILES notation for lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride?
The canonical SMILES for lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride is CCCCOC(=O)c1cc(F)ccc1S(N)(=O)=O.[H-].[Li+].
What is the InChIKey of lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride?
The InChIKey is UYNYBGYRUJCVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO4S.Li.H/c1-2-3-6-17-11(14)9-7-8(12)4-5-10(9)18(13,15)16;;/h4-5,7H,2-3,6H2,1H3,(H2,13,15,16);;/q;+1;-1.
What are the key properties of lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride?
lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride has a molecular weight of 283.25 g/mol, XLogP of -1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;butyl 5-fluoro-2-sulfamoylbenzoate;hydride is sourced from PubChem (CID 174172441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).