About [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid
[3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid (PubChem CID 174172696) has the molecular formula C18H16N4O2
and a molecular weight of 320.35 g/mol. Its IUPAC name is [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid.
Molecular Properties
| Compound Name | [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid |
| PubChem CID | 174172696 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid |
| SMILES | Cc1ccnc([C@H]2C[C@@H]2c2cnc3ccc(NC(=O)O)cc3c2)n1 |
| InChI | InChI=1S/C18H16N4O2/c1-10-4-5-19-17(21-10)15-8-14(15)12-6-11-7-13(22-18(23)24)2-3-16(11)20-9-12/h2-7,9,14-15,22H,8H2,1H3,(H,23,24)/t14-,15+/m1/s1 |
| InChIKey | GGPHXIYVGAAVKY-CABCVRRESA-N |
| XLogP | 3.69 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid?
The IUPAC name of [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid (CID 174172696) is [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid.
What is the SMILES notation for [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid?
The canonical SMILES for [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid is Cc1ccnc([C@H]2C[C@@H]2c2cnc3ccc(NC(=O)O)cc3c2)n1.
What is the InChIKey of [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid?
The InChIKey is GGPHXIYVGAAVKY-CABCVRRESA-N. The full InChI is InChI=1S/C18H16N4O2/c1-10-4-5-19-17(21-10)15-8-14(15)12-6-11-7-13(22-18(23)24)2-3-16(11)20-9-12/h2-7,9,14-15,22H,8H2,1H3,(H,23,24)/t14-,15+/m1/s1.
What are the key properties of [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid?
[3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid has a molecular weight of 320.35 g/mol, XLogP of 3.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1S,2S)-2-(4-methylpyrimidin-2-yl)cyclopropyl]quinolin-6-yl]carbamic acid is sourced from PubChem (CID 174172696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).