C17H19N3O3S — CID 174172924
3-methyl-7,10,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene (PubChem CID 174172924) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-methyl-7,10,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene.
| Compound Name | 3-methyl-7,10,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene |
|---|---|
| PubChem CID | 174172924 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-methyl-7,10,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene |
| SMILES | Cc1nc2sc1-c1n[nH]c3ccc(cc13)OCCCOCCOC2 |
| InChI | InChI=1S/C17H19N3O3S/c1-11-17-16-13-9-12(3-4-14(13)19-20-16)23-6-2-5-21-7-8-22-10-15(18-11)24-17/h3-4,9H,2,5-8,10H2,1H3,(H,19,20) |
| InChIKey | HFWRLBWSSYRTTL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |