About 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid
2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid (PubChem CID 174173034) has the molecular formula C6H9N3O4
and a molecular weight of 187.16 g/mol. Its IUPAC name is 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid.
Molecular Properties
| Compound Name | 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid |
| PubChem CID | 174173034 |
| Molecular Formula | C6H9N3O4 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid |
| SMILES | COc1noc(CCNC(=O)O)n1 |
| InChI | InChI=1S/C6H9N3O4/c1-12-5-8-4(13-9-5)2-3-7-6(10)11/h7H,2-3H2,1H3,(H,10,11) |
| InChIKey | YHCZXLIEIMJHJE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
The IUPAC name of 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid (CID 174173034) is 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid.
What is the SMILES notation for 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
The canonical SMILES for 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid is COc1noc(CCNC(=O)O)n1.
What is the InChIKey of 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
The InChIKey is YHCZXLIEIMJHJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O4/c1-12-5-8-4(13-9-5)2-3-7-6(10)11/h7H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid has a molecular weight of 187.16 g/mol, XLogP of -0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxy-1,2,4-oxadiazol-5-yl)ethylcarbamic acid is sourced from PubChem (CID 174173034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).