C35H56N2O2 — CID 174173464
2,4,5-tris(4-propan-2-ylcyclohexyl)benzene-1,3-dicarboxamide (PubChem CID 174173464) has the molecular formula C35H56N2O2 and a molecular weight of 536.85 g/mol. Its IUPAC name is 2,4,5-tris(4-propan-2-ylcyclohexyl)benzene-1,3-dicarboxamide.
| Compound Name | 2,4,5-tris(4-propan-2-ylcyclohexyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 174173464 |
| Molecular Formula | C35H56N2O2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.43 |
| IUPAC Name | 2,4,5-tris(4-propan-2-ylcyclohexyl)benzene-1,3-dicarboxamide |
| SMILES | CC(C)C1CCC(c2cc(C(N)=O)c(C3CCC(C(C)C)CC3)c(C(N)=O)c2C2CCC(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C35H56N2O2/c1-20(2)23-7-13-26(14-8-23)29-19-30(34(36)38)32(28-17-11-25(12-18-28)22(5)6)33(35(37)39)31(29)27-15-9-24(10-16-27)21(3)4/h19-28H,7-18H2,1-6H3,(H2,36,38)(H2,37,39) |
| InChIKey | HXVXDHVLFHWZDL-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |