About 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one
6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one (PubChem CID 174174548) has the molecular formula C10H14N4O2
and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one |
| PubChem CID | 174174548 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one |
| SMILES | O=c1cc2n([nH]1)CN(N1CCOCC1)C=C2 |
| InChI | InChI=1S/C10H14N4O2/c15-10-7-9-1-2-13(8-14(9)11-10)12-3-5-16-6-4-12/h1-2,7H,3-6,8H2,(H,11,15) |
| InChIKey | WATJFMICQJXIMJ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 53.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one?
The IUPAC name of 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one (CID 174174548) is 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one.
What is the SMILES notation for 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one?
The canonical SMILES for 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one is O=c1cc2n([nH]1)CN(N1CCOCC1)C=C2.
What is the InChIKey of 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one?
The InChIKey is WATJFMICQJXIMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2/c15-10-7-9-1-2-13(8-14(9)11-10)12-3-5-16-6-4-12/h1-2,7H,3-6,8H2,(H,11,15).
What are the key properties of 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one?
6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one has a molecular weight of 222.25 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-morpholin-4-yl-1,7-dihydropyrazolo[1,5-c]pyrimidin-2-one is sourced from PubChem (CID 174174548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).