C25H26ClN5O2 — CID 17417471
1-[(2-chlorophenyl)methyl]-5-oxo-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 17417471) has the molecular formula C25H26ClN5O2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5-oxo-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-5-oxo-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17417471 |
| Molecular Formula | C25H26ClN5O2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5-oxo-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nnc3n2CCCCC3)c1)C1CC(=O)N(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C25H26ClN5O2/c26-21-10-4-3-7-18(21)15-30-16-19(14-23(30)32)25(33)27-20-9-6-8-17(13-20)24-29-28-22-11-2-1-5-12-31(22)24/h3-4,6-10,13,19H,1-2,5,11-12,14-16H2,(H,27,33) |
| InChIKey | UVWPBQFSEMKAQE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |