C27H33N3 — CID 174175150
4,8-bis(ethenyl)-N'-methyl-5-[N-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-C-propylcarbonimidoyl]naphthalene-1-carboximidamide (PubChem CID 174175150) has the molecular formula C27H33N3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 4,8-bis(ethenyl)-N'-methyl-5-[N-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-C-propylcarbonimidoyl]naphthalene-1-carboximidamide.
| Compound Name | 4,8-bis(ethenyl)-N'-methyl-5-[N-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-C-propylcarbonimidoyl]naphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 174175150 |
| Molecular Formula | C27H33N3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 4,8-bis(ethenyl)-N'-methyl-5-[N-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-C-propylcarbonimidoyl]naphthalene-1-carboximidamide |
| SMILES | C=Cc1ccc(/C(CCC)=N/C(=C/C)/C(C)=C\C)c2c(C=C)ccc(/C(N)=N/C)c12 |
| InChI | InChI=1S/C27H33N3/c1-8-13-24(30-23(12-5)18(6)9-2)21-16-14-20(11-4)26-22(27(28)29-7)17-15-19(10-3)25(21)26/h9-12,14-17H,3-4,8,13H2,1-2,5-7H3,(H2,28,29)/b18-9-,23-12+,30-24+ |
| InChIKey | CTGQOXJRAZFSIO-SUDUYTTCSA-N |
| XLogP | 6.92 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|