C10H18BrNO4 — CID 174175672
(2S)-4-bromo-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (PubChem CID 174175672) has the molecular formula C10H18BrNO4 and a molecular weight of 296.16 g/mol. Its IUPAC name is (2S)-4-bromo-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid.
| Compound Name | (2S)-4-bromo-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 174175672 |
| Molecular Formula | C10H18BrNO4 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (2S)-4-bromo-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](CCBr)C(=O)O |
| InChI | InChI=1S/C10H18BrNO4/c1-10(2,3)16-9(15)12(4)7(5-6-11)8(13)14/h7H,5-6H2,1-4H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | WIJOOFUPDMLGQO-ZETCQYMHSA-N |
| XLogP | 2.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|