C26H25N2+ — CID 174176306
N,N-diphenyl-4-(1-propylpyridin-1-ium-4-yl)aniline (PubChem CID 174176306) has the molecular formula C26H25N2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is N,N-diphenyl-4-(1-propylpyridin-1-ium-4-yl)aniline.
| Compound Name | N,N-diphenyl-4-(1-propylpyridin-1-ium-4-yl)aniline |
|---|---|
| PubChem CID | 174176306 |
| Molecular Formula | C26H25N2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N,N-diphenyl-4-(1-propylpyridin-1-ium-4-yl)aniline |
| SMILES | CCC[n+]1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N2/c1-2-19-27-20-17-23(18-21-27)22-13-15-26(16-14-22)28(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-18,20-21H,2,19H2,1H3/q+1 |
| InChIKey | QJEAEORWGNJESO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|