C21H27N3O4 — CID 17417633
3-[2-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 17417633) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[2-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 17417633 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-[2-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CCOc1ccc(C2CCCN2C(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-2-28-16-9-7-15(8-10-16)17-6-5-13-23(17)18(25)14-24-19(26)21(22-20(24)27)11-3-4-12-21/h7-10,17H,2-6,11-14H2,1H3,(H,22,27) |
| InChIKey | QHDUZBATBYTPDE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|