About 2-methoxy-N,4-dimethylpent-1-en-3-amine
2-methoxy-N,4-dimethylpent-1-en-3-amine (PubChem CID 174176571) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-methoxy-N,4-dimethylpent-1-en-3-amine.
Molecular Properties
| Compound Name | 2-methoxy-N,4-dimethylpent-1-en-3-amine |
| PubChem CID | 174176571 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-methoxy-N,4-dimethylpent-1-en-3-amine |
| SMILES | C=C(OC)C(NC)C(C)C |
| InChI | InChI=1S/C8H17NO/c1-6(2)8(9-4)7(3)10-5/h6,8-9H,3H2,1-2,4-5H3 |
| InChIKey | QTXUMXZFFUCNPK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N,4-dimethylpent-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,4-dimethylpent-1-en-3-amine?
The IUPAC name of 2-methoxy-N,4-dimethylpent-1-en-3-amine (CID 174176571) is 2-methoxy-N,4-dimethylpent-1-en-3-amine.
What is the SMILES notation for 2-methoxy-N,4-dimethylpent-1-en-3-amine?
The canonical SMILES for 2-methoxy-N,4-dimethylpent-1-en-3-amine is C=C(OC)C(NC)C(C)C.
What is the InChIKey of 2-methoxy-N,4-dimethylpent-1-en-3-amine?
The InChIKey is QTXUMXZFFUCNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-6(2)8(9-4)7(3)10-5/h6,8-9H,3H2,1-2,4-5H3.
What are the key properties of 2-methoxy-N,4-dimethylpent-1-en-3-amine?
2-methoxy-N,4-dimethylpent-1-en-3-amine has a molecular weight of 143.23 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,4-dimethylpent-1-en-3-amine is sourced from PubChem (CID 174176571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).