C22H27ClF4N2O4 — CID 174176706
(2S,3R)-3-[2-(5-chloro-6-fluoro-4-methylcyclohexa-1,5-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 174176706) has the molecular formula C22H27ClF4N2O4 and a molecular weight of 494.91 g/mol. Its IUPAC name is (2S,3R)-3-[2-(5-chloro-6-fluoro-4-methylcyclohexa-1,5-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[2-(5-chloro-6-fluoro-4-methylcyclohexa-1,5-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174176706 |
| Molecular Formula | C22H27ClF4N2O4 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (2S,3R)-3-[2-(5-chloro-6-fluoro-4-methylcyclohexa-1,5-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | CC1CC=C(CC[C@H]2C(=O)N(C(=O)N[C@@H](C3CCCCC3)C(F)(F)F)[C@@H]2C(=O)O)C(F)=C1Cl |
| InChI | InChI=1S/C22H27ClF4N2O4/c1-11-7-8-12(16(24)15(11)23)9-10-14-17(20(31)32)29(19(14)30)21(33)28-18(22(25,26)27)13-5-3-2-4-6-13/h8,11,13-14,17-18H,2-7,9-10H2,1H3,(H,28,33)(H,31,32)/t11?,14-,17+,18+/m1/s1 |
| InChIKey | TZZOUAWTNVBNHI-GUNFVDQGSA-N |
| XLogP | 5.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |