About (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine
(7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine (PubChem CID 174177002) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine.
Molecular Properties
| Compound Name | (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine |
| PubChem CID | 174177002 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine |
| SMILES | CC(C)C1(C)C=CC(C)(F)/C=N\C=C/1 |
| InChI | InChI=1S/C12H18FN/c1-10(2)11(3)5-6-12(4,13)9-14-8-7-11/h5-10H,1-4H3/b6-5?,8-7-,14-9- |
| InChIKey | IKCKHCISIWJYQK-ROBOGZAOSA-N |
| XLogP | 3.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine?
The IUPAC name of (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine (CID 174177002) is (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine.
What is the SMILES notation for (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine?
The canonical SMILES for (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine is CC(C)C1(C)C=CC(C)(F)/C=N\C=C/1.
What is the InChIKey of (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine?
The InChIKey is IKCKHCISIWJYQK-ROBOGZAOSA-N. The full InChI is InChI=1S/C12H18FN/c1-10(2)11(3)5-6-12(4,13)9-14-8-7-11/h5-10H,1-4H3/b6-5?,8-7-,14-9-.
What are the key properties of (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine?
(7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine has a molecular weight of 195.28 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-3-fluoro-3,6-dimethyl-6-propan-2-ylazocine is sourced from PubChem (CID 174177002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).